C11H14ClN5O — CID 83112157
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea (PubChem CID 83112157) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea.
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83112157 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C11H14ClN5O/c12-8-1-2-10-16-9(7-17(10)6-8)5-14-3-4-15-11(13)18/h1-2,6-7,14H,3-5H2,(H3,13,15,18) |
| InChIKey | AAUZAYDAXGZDQA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|