About 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea (PubChem CID 83112157) has the molecular formula C11H14ClN5O
and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea.
Molecular Properties
| Compound Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea |
| PubChem CID | 83112157 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea |
| SMILES | NC(=O)NCCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C11H14ClN5O/c12-8-1-2-10-16-9(7-17(10)6-8)5-14-3-4-15-11(13)18/h1-2,6-7,14H,3-5H2,(H3,13,15,18) |
| InChIKey | AAUZAYDAXGZDQA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea?
The IUPAC name of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea (CID 83112157) is 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea.
What is the SMILES notation for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea?
The canonical SMILES for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea is NC(=O)NCCNCc1cn2cc(Cl)ccc2n1.
What is the InChIKey of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea?
The InChIKey is AAUZAYDAXGZDQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN5O/c12-8-1-2-10-16-9(7-17(10)6-8)5-14-3-4-15-11(13)18/h1-2,6-7,14H,3-5H2,(H3,13,15,18).
What are the key properties of 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea?
2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea has a molecular weight of 267.72 g/mol, XLogP of 0.75, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]ethylurea is sourced from PubChem (CID 83112157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).