C14H19ClN4O2 — CID 115625613
3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 115625613) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 115625613 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C14H19ClN4O2/c1-21-7-6-17-14(20)4-5-16-8-12-10-19-9-11(15)2-3-13(19)18-12/h2-3,9-10,16H,4-8H2,1H3,(H,17,20) |
| InChIKey | PEVSSMIDDLQOSN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|