C14H18ClN3O — CID 47151010
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexanamide (PubChem CID 47151010) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexanamide.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 47151010 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexanamide |
| SMILES | CCCCCC(=O)NCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C14H18ClN3O/c1-2-3-4-5-14(19)16-8-12-10-18-9-11(15)6-7-13(18)17-12/h6-7,9-10H,2-5,8H2,1H3,(H,16,19) |
| InChIKey | IWDRRIQXPRVENU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|