C14H14ClN3O — CID 47151007
(2E,4E)-N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexa-2,4-dienamide (PubChem CID 47151007) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is (2E,4E)-N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 47151007 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2E,4E)-N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C14H14ClN3O/c1-2-3-4-5-14(19)16-8-12-10-18-9-11(15)6-7-13(18)17-12/h2-7,9-10H,8H2,1H3,(H,16,19)/b3-2+,5-4+ |
| InChIKey | WHCUFASLUPAEQM-MQQKCMAXSA-N |
| XLogP | 2.74 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|