C12H15ClN4O — CID 78998419
3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-methylpropanamide (PubChem CID 78998419) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-methylpropanamide.
| Compound Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 78998419 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-N-methylpropanamide |
| SMILES | CNC(=O)CCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C12H15ClN4O/c1-14-12(18)4-5-15-6-10-8-17-7-9(13)2-3-11(17)16-10/h2-3,7-8,15H,4-6H2,1H3,(H,14,18) |
| InChIKey | IEERKYVEDYUCQZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|