C12H12ClN3 — CID 115866233
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]but-2-yn-1-amine (PubChem CID 115866233) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]but-2-yn-1-amine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 115866233 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]but-2-yn-1-amine |
| SMILES | CC#CCNCc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C12H12ClN3/c1-2-3-6-14-7-11-9-16-8-10(13)4-5-12(16)15-11/h4-5,8-9,14H,6-7H2,1H3 |
| InChIKey | JHKYMCCQDAVBLQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|