C15H21ClN4 — CID 78913138
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 78913138) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 78913138 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | Clc1ccc2nc(CNCCCN3CCCC3)cn2c1 |
| InChI | InChI=1S/C15H21ClN4/c16-13-4-5-15-18-14(12-20(15)11-13)10-17-6-3-9-19-7-1-2-8-19/h4-5,11-12,17H,1-3,6-10H2 |
| InChIKey | KGXKSRNDTDVPAW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|