C11H15Cl3N2 — CID 115281252
N'-[(2,3,6-trichlorophenyl)methyl]butane-1,4-diamine (PubChem CID 115281252) has the molecular formula C11H15Cl3N2 and a molecular weight of 281.61 g/mol. Its IUPAC name is N'-[(2,3,6-trichlorophenyl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(2,3,6-trichlorophenyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115281252 |
| Molecular Formula | C11H15Cl3N2 |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N'-[(2,3,6-trichlorophenyl)methyl]butane-1,4-diamine |
| SMILES | NCCCCNCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H15Cl3N2/c12-9-3-4-10(13)11(14)8(9)7-16-6-2-1-5-15/h3-4,16H,1-2,5-7,15H2 |
| InChIKey | UBDDMVNZDLODLU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|