C17H28N4OS2 — CID 15763415
1,3-bis[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]propan-2-ol (PubChem CID 15763415) has the molecular formula C17H28N4OS2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 1,3-bis[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]propan-2-ol.
| Compound Name | 1,3-bis[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 15763415 |
| Molecular Formula | C17H28N4OS2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1,3-bis[2-(3,5-dimethylpyrazol-1-yl)ethylsulfanyl]propan-2-ol |
| SMILES | Cc1cc(C)n(CCSCC(O)CSCCn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C17H28N4OS2/c1-13-9-15(3)20(18-13)5-7-23-11-17(22)12-24-8-6-21-16(4)10-14(2)19-21/h9-10,17,22H,5-8,11-12H2,1-4H3 |
| InChIKey | BOSMKBLXSQTHBP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|