C9H14BrN3O — CID 82110482
2-bromo-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]acetamide (PubChem CID 82110482) has the molecular formula C9H14BrN3O and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-bromo-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-bromo-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 82110482 |
| Molecular Formula | C9H14BrN3O |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-bromo-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]acetamide |
| SMILES | Cc1cc(C)n(CCNC(=O)CBr)n1 |
| InChI | InChI=1S/C9H14BrN3O/c1-7-5-8(2)13(12-7)4-3-11-9(14)6-10/h5H,3-4,6H2,1-2H3,(H,11,14) |
| InChIKey | ASOSBLOTCSSYKC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|