C9H15N3OS — CID 19525804
2-(3,5-dimethylpyrazol-1-yl)-N-(2-sulfanylethyl)acetamide (PubChem CID 19525804) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-(2-sulfanylethyl)acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 19525804 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(2-sulfanylethyl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NCCS)n1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-5-8(2)12(11-7)6-9(13)10-3-4-14/h5,14H,3-4,6H2,1-2H3,(H,10,13) |
| InChIKey | FONOTROUVKRMNS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|