C13H25N3O4Si — CID 156761758
2-(3,5-dimethylpyrazol-1-yl)-N-(3-trimethoxysilylpropyl)acetamide (PubChem CID 156761758) has the molecular formula C13H25N3O4Si and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-(3-trimethoxysilylpropyl)acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(3-trimethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 156761758 |
| Molecular Formula | C13H25N3O4Si |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-(3-trimethoxysilylpropyl)acetamide |
| SMILES | CO[Si](CCCNC(=O)Cn1nc(C)cc1C)(OC)OC |
| InChI | InChI=1S/C13H25N3O4Si/c1-11-9-12(2)16(15-11)10-13(17)14-7-6-8-21(18-3,19-4)20-5/h9H,6-8,10H2,1-5H3,(H,14,17) |
| InChIKey | ILJOQFGWEMIWPK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|