C16H21N3O — CID 35761342
N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-3-phenylpropanamide (PubChem CID 35761342) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 35761342 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-3-phenylpropanamide |
| SMILES | Cc1cc(C)n(CCNC(=O)CCc2ccccc2)n1 |
| InChI | InChI=1S/C16H21N3O/c1-13-12-14(2)19(18-13)11-10-17-16(20)9-8-15-6-4-3-5-7-15/h3-7,12H,8-11H2,1-2H3,(H,17,20) |
| InChIKey | PAHCSTKZXIXLPO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |