C15H19N3O — CID 19328839
N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-phenylpropanamide (PubChem CID 19328839) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-phenylpropanamide.
| Compound Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 19328839 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-3-phenylpropanamide |
| SMILES | Cc1cc(CNC(=O)CCc2ccccc2)nn1C |
| InChI | InChI=1S/C15H19N3O/c1-12-10-14(17-18(12)2)11-16-15(19)9-8-13-6-4-3-5-7-13/h3-7,10H,8-9,11H2,1-2H3,(H,16,19) |
| InChIKey | HULHREMSSLAEMI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |