C16H21N3O2 — CID 115603539
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(3-hydroxyphenyl)acetamide (PubChem CID 115603539) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 115603539 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-(3-hydroxyphenyl)acetamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C16H21N3O2/c1-12-9-13(2)19(18-12)8-4-7-17-16(21)11-14-5-3-6-15(20)10-14/h3,5-6,9-10,20H,4,7-8,11H2,1-2H3,(H,17,21) |
| InChIKey | MMWHIAOBDKHHHZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|