C17H23ClN4O — CID 86914201
1-[2-(3-chlorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 86914201) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 86914201 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)NCCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H23ClN4O/c1-13-11-14(2)22(21-13)10-4-8-19-17(23)20-9-7-15-5-3-6-16(18)12-15/h3,5-6,11-12H,4,7-10H2,1-2H3,(H2,19,20,23) |
| InChIKey | MHXANMVAXOJOOF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|