C14H20N6S — CID 107548151
2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-6-methylpyrimidine-4-carbothioamide (PubChem CID 107548151) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-6-methylpyrimidine-4-carbothioamide.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-6-methylpyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548151 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propylamino]-6-methylpyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(NCCCn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C14H20N6S/c1-9-8-12(13(15)21)18-14(17-9)16-5-4-6-20-11(3)7-10(2)19-20/h7-8H,4-6H2,1-3H3,(H2,15,21)(H,16,17,18) |
| InChIKey | MHBLGHCLOUYJRW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|