C12H16N6S — CID 107548008
6-methyl-2-(3-pyrazol-1-ylpropylamino)pyrimidine-4-carbothioamide (PubChem CID 107548008) has the molecular formula C12H16N6S and a molecular weight of 276.37 g/mol. Its IUPAC name is 6-methyl-2-(3-pyrazol-1-ylpropylamino)pyrimidine-4-carbothioamide.
| Compound Name | 6-methyl-2-(3-pyrazol-1-ylpropylamino)pyrimidine-4-carbothioamide |
|---|---|
| PubChem CID | 107548008 |
| Molecular Formula | C12H16N6S |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 6-methyl-2-(3-pyrazol-1-ylpropylamino)pyrimidine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)nc(NCCCn2cccn2)n1 |
| InChI | InChI=1S/C12H16N6S/c1-9-8-10(11(13)19)17-12(16-9)14-4-2-6-18-7-3-5-15-18/h3,5,7-8H,2,4,6H2,1H3,(H2,13,19)(H,14,16,17) |
| InChIKey | KWGUOSHNGKRGGB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|