C17H18F4N2O2 — CID 176582611
2-[[5-amino-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol (PubChem CID 176582611) has the molecular formula C17H18F4N2O2 and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-[[5-amino-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[5-amino-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 176582611 |
| Molecular Formula | C17H18F4N2O2 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[[5-amino-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| SMILES | Nc1ccc(OCc2ccc(F)c(C(F)(F)F)c2)c(CNCCO)c1 |
| InChI | InChI=1S/C17H18F4N2O2/c18-15-3-1-11(7-14(15)17(19,20)21)10-25-16-4-2-13(22)8-12(16)9-23-5-6-24/h1-4,7-8,23-24H,5-6,9-10,22H2 |
| InChIKey | JNISVABTOVGQDE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|