C19H16BrF4NO2 — CID 168959504
2-[[5-bromo-4-ethynyl-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol (PubChem CID 168959504) has the molecular formula C19H16BrF4NO2 and a molecular weight of 446.24 g/mol. Its IUPAC name is 2-[[5-bromo-4-ethynyl-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[5-bromo-4-ethynyl-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 168959504 |
| Molecular Formula | C19H16BrF4NO2 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 2-[[5-bromo-4-ethynyl-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| SMILES | C#Cc1cc(OCc2ccc(F)c(C(F)(F)F)c2)c(CNCCO)cc1Br |
| InChI | InChI=1S/C19H16BrF4NO2/c1-2-13-9-18(14(8-16(13)20)10-25-5-6-26)27-11-12-3-4-17(21)15(7-12)19(22,23)24/h1,3-4,7-9,25-26H,5-6,10-11H2 |
| InChIKey | OTVZJMQLDWXJIT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|