C22H19Cl2N3O2 — CID 17057906
5-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 17057906) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 5-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 17057906 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 5-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1ccc(COc2c(Cl)cc(Cl)cc2CNc2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c1-13-2-4-14(5-3-13)12-29-21-15(8-16(23)9-18(21)24)11-25-17-6-7-19-20(10-17)27-22(28)26-19/h2-10,25H,11-12H2,1H3,(H2,26,27,28) |
| InChIKey | PQPHVEQNYBJGRH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|