C21H19ClFN3O2 — CID 17060219
5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride (PubChem CID 17060219) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is 5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride.
| Compound Name | 5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 17060219 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylamino]-1,3-dihydrobenzimidazol-2-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ccc(NCc3cccc(OCc4ccccc4F)c3)cc2[nH]1 |
| InChI | InChI=1S/C21H18FN3O2.ClH/c22-18-7-2-1-5-15(18)13-27-17-6-3-4-14(10-17)12-23-16-8-9-19-20(11-16)25-21(26)24-19;/h1-11,23H,12-13H2,(H2,24,25,26);1H |
| InChIKey | WFULNPWJTJVOBO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|