C13H15N5O — CID 43644891
5-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 43644891) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 43644891 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 5-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1n[nH]c(C)c1CNc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H15N5O/c1-7-10(8(2)18-17-7)6-14-9-3-4-11-12(5-9)16-13(19)15-11/h3-5,14H,6H2,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | HGLJIUVMFOAEOK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|