C14H17N3O2 — CID 43645040
methyl 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]benzoate (PubChem CID 43645040) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]benzoate.
| Compound Name | methyl 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 43645040 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | methyl 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCc2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-13(10(2)17-16-9)8-15-12-6-4-11(5-7-12)14(18)19-3/h4-7,15H,8H2,1-3H3,(H,16,17) |
| InChIKey | XEKXNASCWXVSOJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |