C13H15F2N3O — CID 43644895
4-(difluoromethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 43644895) has the molecular formula C13H15F2N3O and a molecular weight of 267.28 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 4-(difluoromethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43644895 |
| Molecular Formula | C13H15F2N3O |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Cc1n[nH]c(C)c1CNc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H15F2N3O/c1-8-12(9(2)18-17-8)7-16-10-3-5-11(6-4-10)19-13(14)15/h3-6,13,16H,7H2,1-2H3,(H,17,18) |
| InChIKey | PUBRRKMKGPOSII-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|