C13H17N3O3 — CID 115233592
methyl 2,2-dimethyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propanoate (PubChem CID 115233592) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propanoate |
|---|---|
| PubChem CID | 115233592 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 2,2-dimethyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propanoate |
| SMILES | COC(=O)C(C)(C)CNc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H17N3O3/c1-13(2,11(17)19-3)7-14-8-4-5-9-10(6-8)16-12(18)15-9/h4-6,14H,7H2,1-3H3,(H2,15,16,18) |
| InChIKey | AAKCSJFKAXDGSC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|