C17H21N3O7 — CID 126656234
diethyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl methanetricarboxylate (PubChem CID 126656234) has the molecular formula C17H21N3O7 and a molecular weight of 379.37 g/mol. Its IUPAC name is diethyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl methanetricarboxylate.
| Compound Name | diethyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl methanetricarboxylate |
|---|---|
| PubChem CID | 126656234 |
| Molecular Formula | C17H21N3O7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | diethyl 2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]ethyl methanetricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)OCCNc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H21N3O7/c1-3-25-14(21)13(15(22)26-4-2)16(23)27-8-7-18-10-5-6-11-12(9-10)20-17(24)19-11/h5-6,9,13,18H,3-4,7-8H2,1-2H3,(H2,19,20,24) |
| InChIKey | DTYSALRFRZYUMA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|