C12H15N3O3 — CID 99636827
methyl (2S)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butanoate (PubChem CID 99636827) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl (2S)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butanoate.
| Compound Name | methyl (2S)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butanoate |
|---|---|
| PubChem CID | 99636827 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | methyl (2S)-2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]butanoate |
| SMILES | CC[C@H](Nc1ccc2[nH]c(=O)[nH]c2c1)C(=O)OC |
| InChI | InChI=1S/C12H15N3O3/c1-3-8(11(16)18-2)13-7-4-5-9-10(6-7)15-12(17)14-9/h4-6,8,13H,3H2,1-2H3,(H2,14,15,17)/t8-/m0/s1 |
| InChIKey | ZCXHXUXGTIKZTG-QMMMGPOBSA-N |
| XLogP | 1.22 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |