C12H17N3O — CID 28622281
5-(3-methylbutylamino)-1,3-dihydrobenzimidazol-2-one (PubChem CID 28622281) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-(3-methylbutylamino)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(3-methylbutylamino)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 28622281 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-(3-methylbutylamino)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC(C)CCNc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3O/c1-8(2)5-6-13-9-3-4-10-11(7-9)15-12(16)14-10/h3-4,7-8,13H,5-6H2,1-2H3,(H2,14,15,16) |
| InChIKey | GHQXJBLFHLEHOG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|