C14H19N3O3 — CID 106675245
6-[(3-methoxy-3-methylbutyl)amino]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 106675245) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-[(3-methoxy-3-methylbutyl)amino]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[(3-methoxy-3-methylbutyl)amino]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 106675245 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 6-[(3-methoxy-3-methylbutyl)amino]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COC(C)(C)CCNc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H19N3O3/c1-14(2,20-3)6-7-15-9-4-5-10-11(8-9)17-13(19)12(18)16-10/h4-5,8,15H,6-7H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ATUDGXOGJJSTBJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|