C13H12N4S — CID 62759823
4-(1H-pyrazol-5-yl)-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 62759823) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-(1H-pyrazol-5-yl)-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 4-(1H-pyrazol-5-yl)-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 62759823 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(1H-pyrazol-5-yl)-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | c1cc(-c2ccc(NCc3cncs3)cc2)[nH]n1 |
| InChI | InChI=1S/C13H12N4S/c1-3-11(15-8-12-7-14-9-18-12)4-2-10(1)13-5-6-16-17-13/h1-7,9,15H,8H2,(H,16,17) |
| InChIKey | RQPCWEUXLADMKY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |