C9H9F3N2O — CID 60704273
[4-methyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 60704273) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is [4-methyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | [4-methyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 60704273 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | [4-methyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(NC(N)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O/c1-5-2-3-6(14-8(13)15)4-7(5)9(10,11)12/h2-4H,1H3,(H3,13,14,15) |
| InChIKey | NWCLNFGNBGWDOL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |