C16H21ClN2O2 — CID 106502684
(2-chloro-5-hydroxyphenyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone (PubChem CID 106502684) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is (2-chloro-5-hydroxyphenyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-hydroxyphenyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 106502684 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2-chloro-5-hydroxyphenyl)-[4-(cyclopropylmethylamino)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(O)ccc1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C16H21ClN2O2/c17-15-4-3-13(20)9-14(15)16(21)19-7-5-12(6-8-19)18-10-11-1-2-11/h3-4,9,11-12,18,20H,1-2,5-8,10H2 |
| InChIKey | XBFMTLNPJWVWMQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |