C24H30F3N3O2 — CID 51636167
4-methoxy-2-[[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methyl]phenol (PubChem CID 51636167) has the molecular formula C24H30F3N3O2 and a molecular weight of 449.52 g/mol. Its IUPAC name is 4-methoxy-2-[[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 4-methoxy-2-[[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 51636167 |
| Molecular Formula | C24H30F3N3O2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-methoxy-2-[[(3R)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methyl]phenol |
| SMILES | COc1ccc(O)c(CN2CCC[C@@H](N3CCN(c4cccc(C(F)(F)F)c4)CC3)C2)c1 |
| InChI | InChI=1S/C24H30F3N3O2/c1-32-22-7-8-23(31)18(14-22)16-28-9-3-6-21(17-28)30-12-10-29(11-13-30)20-5-2-4-19(15-20)24(25,26)27/h2,4-5,7-8,14-15,21,31H,3,6,9-13,16-17H2,1H3/t21-/m1/s1 |
| InChIKey | DSLMRCXEXGHJEU-OAQYLSRUSA-N |
| XLogP | 4.21 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|