C15H19F3N2S — CID 30983731
1-[(3R)-thiolan-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 30983731) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-[(3R)-thiolan-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(3R)-thiolan-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 30983731 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-[(3R)-thiolan-3-yl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN([C@@H]3CCSC3)CC2)c1 |
| InChI | InChI=1S/C15H19F3N2S/c16-15(17,18)12-2-1-3-13(10-12)19-5-7-20(8-6-19)14-4-9-21-11-14/h1-3,10,14H,4-9,11H2/t14-/m1/s1 |
| InChIKey | OGILVWZUIHJFGQ-CQSZACIVSA-N |
| XLogP | 3.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |