C25H26F3N3O — CID 42517260
(3-ethynylphenyl)-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 42517260) has the molecular formula C25H26F3N3O and a molecular weight of 441.50 g/mol. Its IUPAC name is (3-ethynylphenyl)-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | (3-ethynylphenyl)-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42517260 |
| Molecular Formula | C25H26F3N3O |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (3-ethynylphenyl)-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | C#Cc1cccc(C(=O)N2CCC[C@H](N3CCN(c4cccc(C(F)(F)F)c4)CC3)C2)c1 |
| InChI | InChI=1S/C25H26F3N3O/c1-2-19-6-3-7-20(16-19)24(32)31-11-5-10-23(18-31)30-14-12-29(13-15-30)22-9-4-8-21(17-22)25(26,27)28/h1,3-4,6-9,16-17,23H,5,10-15,18H2/t23-/m0/s1 |
| InChIKey | SHDWQOUBDMDTDX-QHCPKHFHSA-N |
| XLogP | 4.11 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|