C23H23F3N3O+ — CID 8548032
N-naphthalen-2-yl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8548032) has the molecular formula C23H23F3N3O+ and a molecular weight of 414.45 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-naphthalen-2-yl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8548032 |
| Molecular Formula | C23H23F3N3O+ |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-naphthalen-2-yl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H22F3N3O/c24-23(25,26)19-6-3-7-21(15-19)29-12-10-28(11-13-29)16-22(30)27-20-9-8-17-4-1-2-5-18(17)14-20/h1-9,14-15H,10-13,16H2,(H,27,30)/p+1 |
| InChIKey | RFXGDVGAXFBBQE-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |