C19H19F3N3+ — CID 8547871
3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]benzonitrile (PubChem CID 8547871) has the molecular formula C19H19F3N3+ and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 8547871 |
| Molecular Formula | C19H19F3N3+ |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(C[NH+]2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C19H18F3N3/c20-19(21,22)17-5-2-6-18(12-17)25-9-7-24(8-10-25)14-16-4-1-3-15(11-16)13-23/h1-6,11-12H,7-10,14H2/p+1 |
| InChIKey | ITSCGVIQRUFHHJ-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 31.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |