C15H19F3N3+ — CID 3045655
3-[1-methyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]propanenitrile (PubChem CID 3045655) has the molecular formula C15H19F3N3+ and a molecular weight of 298.33 g/mol. Its IUPAC name is 3-[1-methyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]propanenitrile.
| Compound Name | 3-[1-methyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 3045655 |
| Molecular Formula | C15H19F3N3+ |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[1-methyl-4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]propanenitrile |
| SMILES | C[N+]1(CCC#N)CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H19F3N3/c1-21(9-3-6-19)10-7-20(8-11-21)14-5-2-4-13(12-14)15(16,17)18/h2,4-5,12H,3,7-11H2,1H3/q+1 |
| InChIKey | YWZPGMKSNBFNLJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|