C16H23ClN4 — CID 139642343
6-chloro-2-N,3-N-bis(2-methylpropyl)quinoxaline-2,3-diamine (PubChem CID 139642343) has the molecular formula C16H23ClN4 and a molecular weight of 306.84 g/mol. Its IUPAC name is 6-chloro-2-N,3-N-bis(2-methylpropyl)quinoxaline-2,3-diamine.
| Compound Name | 6-chloro-2-N,3-N-bis(2-methylpropyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 139642343 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 6-chloro-2-N,3-N-bis(2-methylpropyl)quinoxaline-2,3-diamine |
| SMILES | CC(C)CNc1nc2ccc(Cl)cc2nc1NCC(C)C |
| InChI | InChI=1S/C16H23ClN4/c1-10(2)8-18-15-16(19-9-11(3)4)21-14-7-12(17)5-6-13(14)20-15/h5-7,10-11H,8-9H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | FTKXABDCQSENDW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |