C15H7Cl2N3 — CID 134997494
3,10-dichloroquinolino[2,3-c]cinnoline (PubChem CID 134997494) has the molecular formula C15H7Cl2N3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3,10-dichloroquinolino[2,3-c]cinnoline.
| Compound Name | 3,10-dichloroquinolino[2,3-c]cinnoline |
|---|---|
| PubChem CID | 134997494 |
| Molecular Formula | C15H7Cl2N3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3,10-dichloroquinolino[2,3-c]cinnoline |
| SMILES | Clc1ccc2nc3nnc4cc(Cl)ccc4c3cc2c1 |
| InChI | InChI=1S/C15H7Cl2N3/c16-9-2-4-13-8(5-9)6-12-11-3-1-10(17)7-14(11)19-20-15(12)18-13/h1-7H |
| InChIKey | MGQIUAWNYLXJTG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|