C41H14BF20N — CID 175694435
methylazanium;tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide (PubChem CID 175694435) has the molecular formula C41H14BF20N and a molecular weight of 911.34 g/mol. Its IUPAC name is methylazanium;tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide.
| Compound Name | methylazanium;tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide |
|---|---|
| PubChem CID | 175694435 |
| Molecular Formula | C41H14BF20N |
| Molecular Weight | 911.34 g/mol |
| Exact Mass | 911.09 |
| IUPAC Name | methylazanium;tetrakis(2,3,4,5,6-pentafluoronaphthalen-1-yl)boranuide |
| SMILES | C[NH3+].Fc1ccc2c([B-](c3c(F)c(F)c(F)c4c(F)c(F)ccc34)(c3c(F)c(F)c(F)c4c(F)c(F)ccc34)c3c(F)c(F)c(F)c4c(F)c(F)ccc34)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C40H8BF20.CH5N/c42-13-5-1-9-17(25(13)46)29(50)37(58)33(54)21(9)41(22-10-2-6-14(43)26(47)18(10)30(51)38(59)34(22)55,23-11-3-7-15(44)27(48)19(11)31(52)39(60)35(23)56)24-12-4-8-16(45)28(49)20(12)32(53)40(61)36(24)57;1-2/h1-8H;2H2,1H3/q-1;/p+1 |
| InChIKey | JIKBEPMXCYDPRI-UHFFFAOYSA-O |
| XLogP | 9.32 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.34 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|