C42H14BF30N — CID 174050248
butyl-bis[difluoro-(2,3,4-trifluorophenyl)methyl]azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 174050248) has the molecular formula C42H14BF30N and a molecular weight of 1113.33 g/mol. Its IUPAC name is butyl-bis[difluoro-(2,3,4-trifluorophenyl)methyl]azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | butyl-bis[difluoro-(2,3,4-trifluorophenyl)methyl]azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 174050248 |
| Molecular Formula | C42H14BF30N |
| Molecular Weight | 1113.33 g/mol |
| Exact Mass | 1113.07 |
| IUPAC Name | butyl-bis[difluoro-(2,3,4-trifluorophenyl)methyl]azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCC[NH+](C(F)(F)c1ccc(F)c(F)c1F)C(F)(F)c1ccc(F)c(F)c1F.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C18H13F10N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-2-3-8-29(17(25,26)9-4-6-11(19)15(23)13(9)21)18(27,28)10-5-7-12(20)16(24)14(10)22/h;4-7H,2-3,8H2,1H3/q-1;/p+1 |
| InChIKey | BDSYSIWJYKTIPW-UHFFFAOYSA-O |
| XLogP | 10.85 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.33 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|