C56H68BF20P — CID 134716571
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tetraoctylphosphanium (PubChem CID 134716571) has the molecular formula C56H68BF20P and a molecular weight of 1162.91 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tetraoctylphosphanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tetraoctylphosphanium |
|---|---|
| PubChem CID | 134716571 |
| Molecular Formula | C56H68BF20P |
| Molecular Weight | 1162.91 g/mol |
| Exact Mass | 1162.48 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tetraoctylphosphanium |
| SMILES | CCCCCCCC[P+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H68P.C24BF20/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h5-32H2,1-4H3;/q+1;-1 |
| InChIKey | HOEQCDKFSTWQEG-UHFFFAOYSA-N |
| XLogP | 18.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 32 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1162.91 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|