C40H36BF20N — CID 175866120
dioctylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 175866120) has the molecular formula C40H36BF20N and a molecular weight of 921.51 g/mol. Its IUPAC name is dioctylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dioctylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 175866120 |
| Molecular Formula | C40H36BF20N |
| Molecular Weight | 921.51 g/mol |
| Exact Mass | 921.26 |
| IUPAC Name | dioctylazanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCCCCCC[NH2+]CCCCCCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C16H35N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2/h;17H,3-16H2,1-2H3/q-1;/p+1 |
| InChIKey | QSRZDIPVFCHCRV-UHFFFAOYSA-O |
| XLogP | 10.12 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.51 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|