C35H26BF20N — CID 177344477
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trimethyl(octyl)azanium (PubChem CID 177344477) has the molecular formula C35H26BF20N and a molecular weight of 851.37 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trimethyl(octyl)azanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trimethyl(octyl)azanium |
|---|---|
| PubChem CID | 177344477 |
| Molecular Formula | C35H26BF20N |
| Molecular Weight | 851.37 g/mol |
| Exact Mass | 851.18 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;trimethyl(octyl)azanium |
| SMILES | CCCCCCCC[N+](C)(C)C.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C11H26N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-5-6-7-8-9-10-11-12(2,3)4/h;5-11H2,1-4H3/q-1;+1 |
| InChIKey | LTUFNSWSCKPQIX-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.37 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|