C49H54BF20N — CID 177344479
methyl(trioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 177344479) has the molecular formula C49H54BF20N and a molecular weight of 1047.75 g/mol. Its IUPAC name is methyl(trioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | methyl(trioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 177344479 |
| Molecular Formula | C49H54BF20N |
| Molecular Weight | 1047.75 g/mol |
| Exact Mass | 1047.40 |
| IUPAC Name | methyl(trioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H54N.C24BF20/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h5-25H2,1-4H3;/q+1;-1 |
| InChIKey | JYABGANIRJBHTD-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.75 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|