About sodium;1-fluoronaphthalene;hydride
sodium;1-fluoronaphthalene;hydride (PubChem CID 174852667) has the molecular formula C10H8FNa
and a molecular weight of 170.16 g/mol. Its IUPAC name is sodium;1-fluoronaphthalene;hydride.
Molecular Properties
| Compound Name | sodium;1-fluoronaphthalene;hydride |
| PubChem CID | 174852667 |
| Molecular Formula | C10H8FNa |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | sodium;1-fluoronaphthalene;hydride |
| SMILES | Fc1cccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C10H7F.Na.H/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H;;/q;+1;-1 |
| InChIKey | STYKAMYHTDDWCG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sodium;1-fluoronaphthalene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-fluoronaphthalene;hydride?
The IUPAC name of sodium;1-fluoronaphthalene;hydride (CID 174852667) is sodium;1-fluoronaphthalene;hydride.
What is the SMILES notation for sodium;1-fluoronaphthalene;hydride?
The canonical SMILES for sodium;1-fluoronaphthalene;hydride is Fc1cccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;1-fluoronaphthalene;hydride?
The InChIKey is STYKAMYHTDDWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F.Na.H/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H;;/q;+1;-1.
What are the key properties of sodium;1-fluoronaphthalene;hydride?
sodium;1-fluoronaphthalene;hydride has a molecular weight of 170.16 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-fluoronaphthalene;hydride is sourced from PubChem (CID 174852667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).