About 1,2-difluorobenzene;hydrazine;hydrobromide
1,2-difluorobenzene;hydrazine;hydrobromide (PubChem CID 174886946) has the molecular formula C6H9BrF2N2
and a molecular weight of 227.05 g/mol. Its IUPAC name is 1,2-difluorobenzene;hydrazine;hydrobromide.
Molecular Properties
| Compound Name | 1,2-difluorobenzene;hydrazine;hydrobromide |
| PubChem CID | 174886946 |
| Molecular Formula | C6H9BrF2N2 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 1,2-difluorobenzene;hydrazine;hydrobromide |
| SMILES | Br.Fc1ccccc1F.NN |
| InChI | InChI=1S/C6H4F2.BrH.H4N2/c7-5-3-1-2-4-6(5)8;;1-2/h1-4H;1H;1-2H2 |
| InChIKey | GWABVPMWEPSNQF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluorobenzene;hydrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluorobenzene;hydrazine;hydrobromide?
The IUPAC name of 1,2-difluorobenzene;hydrazine;hydrobromide (CID 174886946) is 1,2-difluorobenzene;hydrazine;hydrobromide.
What is the SMILES notation for 1,2-difluorobenzene;hydrazine;hydrobromide?
The canonical SMILES for 1,2-difluorobenzene;hydrazine;hydrobromide is Br.Fc1ccccc1F.NN.
What is the InChIKey of 1,2-difluorobenzene;hydrazine;hydrobromide?
The InChIKey is GWABVPMWEPSNQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2.BrH.H4N2/c7-5-3-1-2-4-6(5)8;;1-2/h1-4H;1H;1-2H2.
What are the key properties of 1,2-difluorobenzene;hydrazine;hydrobromide?
1,2-difluorobenzene;hydrazine;hydrobromide has a molecular weight of 227.05 g/mol, XLogP of 1.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluorobenzene;hydrazine;hydrobromide is sourced from PubChem (CID 174886946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).