About aniline;2-fluoroaniline
aniline;2-fluoroaniline (PubChem CID 154966061) has the molecular formula C12H13FN2
and a molecular weight of 204.25 g/mol. Its IUPAC name is aniline;2-fluoroaniline.
Molecular Properties
| Compound Name | aniline;2-fluoroaniline |
| PubChem CID | 154966061 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | aniline;2-fluoroaniline |
| SMILES | Nc1ccccc1.Nc1ccccc1F |
| InChI | InChI=1S/C6H6FN.C6H7N/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4H,8H2;1-5H,7H2 |
| InChIKey | DEIDPPOULDMUJQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;2-fluoroaniline?
The IUPAC name of aniline;2-fluoroaniline (CID 154966061) is aniline;2-fluoroaniline.
What is the SMILES notation for aniline;2-fluoroaniline?
The canonical SMILES for aniline;2-fluoroaniline is Nc1ccccc1.Nc1ccccc1F.
What is the InChIKey of aniline;2-fluoroaniline?
The InChIKey is DEIDPPOULDMUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C6H7N/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4H,8H2;1-5H,7H2.
What are the key properties of aniline;2-fluoroaniline?
aniline;2-fluoroaniline has a molecular weight of 204.25 g/mol, XLogP of 2.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;2-fluoroaniline is sourced from PubChem (CID 154966061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).